Products 2193051-93-1
CAS 2193051-93-1 is the registry number for 5-((1S)-1-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)ethyl)-2-methoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[(1S)-1-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-2-methoxybenzoic acid (CAS 2193051-93-1) is a chemical compound with the molecular formula C25H23NO5 and a molecular weight of 417.5 g/mol. IUPAC name: 5-[(1S)-1-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-2-methoxybenzoic acid. InChIKey: HMBIWXASQMHQJF-HNNXBMFYSA-N.
| Molecular formula | C25H23NO5 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | 5-[(1S)-1-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-2-methoxybenzoic acid |
| InChIKey | HMBIWXASQMHQJF-HNNXBMFYSA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)OC)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)