CAS 2193051-94-2 appears in our catalog under these names: (2S,4R)-4-Fluoro-2-(trifluoromethyl)pyrrolidine hydrochloride, (2S,4R)-4-Fluoro-2-(trifluoromethyl)pyrrolidine hydrochloride, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g, 5g.
(2S,4R)-4-fluoro-2-(trifluoromethyl)pyrrolidine;hydrochloride (CAS 2193051-94-2) is a chemical compound with the molecular formula C5H8ClF4N and a molecular weight of 193.57 g/mol. IUPAC name: (2S,4R)-4-fluoro-2-(trifluoromethyl)pyrrolidine;hydrochloride. InChIKey: ABYPTFVDRSVIGM-HJXLNUONSA-N.
| Molecular formula | C5H8ClF4N |
|---|---|
| Molecular weight | 193.57 g/mol |
| IUPAC name | (2S,4R)-4-fluoro-2-(trifluoromethyl)pyrrolidine;hydrochloride |
| InChIKey | ABYPTFVDRSVIGM-HJXLNUONSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(F)(F)F)F.Cl |
Computed by PubChem (NCBI)