CAS 2219353-73-6 appears in our catalog under these names: (2R,4S)-4-Fluoro-2-(trifluoromethyl)pyrrolidine hydrochloride, 95%, (2R,4S)-4-Fluoro-2-(trifluoromethyl)pyrrolidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidine;hydrochloride (CAS 2219353-73-6) is a chemical compound with the molecular formula C5H8ClF4N and a molecular weight of 193.57 g/mol. IUPAC name: (2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidine;hydrochloride. InChIKey: ABYPTFVDRSVIGM-RFKZQXLXSA-N.
| Molecular formula | C5H8ClF4N |
|---|---|
| Molecular weight | 193.57 g/mol |
| IUPAC name | (2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidine;hydrochloride |
| InChIKey | ABYPTFVDRSVIGM-RFKZQXLXSA-N |
| SMILES | C1[C@@H](CN[C@H]1C(F)(F)F)F.Cl |
Computed by PubChem (NCBI)