CAS 2193058-62-5 is the registry number for 11-Oxa-8,13-diazadispiro(3.0.5{5}.3{4})tridecan-12-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
11-oxa-8,13-diazadispiro[3.0.55.34]tridecan-12-one;hydrochloride (CAS 2193058-62-5) is a chemical compound with the molecular formula C10H17ClN2O2 and a molecular weight of 232.71 g/mol. IUPAC name: 11-oxa-8,13-diazadispiro[3.0.55.34]tridecan-12-one;hydrochloride. InChIKey: PPAQKTCHTVQIFP-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2O2 |
|---|---|
| Molecular weight | 232.71 g/mol |
| IUPAC name | 11-oxa-8,13-diazadispiro[3.0.55.34]tridecan-12-one;hydrochloride |
| InChIKey | PPAQKTCHTVQIFP-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)C3(CCNCC3)OC(=O)N2.Cl |
Computed by PubChem (NCBI)