Products 2241130-81-2
CAS 2241130-81-2 is the registry number for 1-(Piperidin-4-yl)piperidine-2,6-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-piperidin-4-ylpiperidine-2,6-dione;hydrochloride (CAS 2241130-81-2) is a chemical compound with the molecular formula C10H17ClN2O2 and a molecular weight of 232.71 g/mol. IUPAC name: 1-piperidin-4-ylpiperidine-2,6-dione;hydrochloride. InChIKey: ZCWLEZRPAWODHS-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2O2 |
|---|---|
| Molecular weight | 232.71 g/mol |
| IUPAC name | 1-piperidin-4-ylpiperidine-2,6-dione;hydrochloride |
| InChIKey | ZCWLEZRPAWODHS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C(=O)C1)C2CCNCC2.Cl |
Computed by PubChem (NCBI)