Products 2193065-23-3
CAS 2193065-23-3 is the registry number for 1-{((tert-Butoxy)carbonyl)amino}-2,5-dimethyl-1H-pyrrole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3-carboxylic acid (CAS 2193065-23-3) is a chemical compound with the molecular formula C12H18N2O4 and a molecular weight of 254.28 g/mol. IUPAC name: 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3-carboxylic acid. InChIKey: VFLQYBUKSHIQRQ-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O4 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 2,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrole-3-carboxylic acid |
| InChIKey | VFLQYBUKSHIQRQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1NC(=O)OC(C)(C)C)C)C(=O)O |
Computed by PubChem (NCBI)