CAS 2193067-47-7 is the registry number for 4,5,6,7-Tetrahydrobenzo(d)thiazole-2-sulfonyl fluoride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
4,5,6,7-tetrahydro-1,3-benzothiazole-2-sulfonyl fluoride (CAS 2193067-47-7) is a chemical compound with the molecular formula C7H8FNO2S2 and a molecular weight of 221.3 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1,3-benzothiazole-2-sulfonyl fluoride. InChIKey: QFLZEHMGXFYTRT-UHFFFAOYSA-N.
| Molecular formula | C7H8FNO2S2 |
|---|---|
| Molecular weight | 221.3 g/mol |
| IUPAC name | 4,5,6,7-tetrahydro-1,3-benzothiazole-2-sulfonyl fluoride |
| InChIKey | QFLZEHMGXFYTRT-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)N=C(S2)S(=O)(=O)F |
Computed by PubChem (NCBI)