CAS 2375924-09-5 is the registry number for rel-2-(((1R,2R)-2-Fluorocyclopropyl)sulfonyl)-4-methylthiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1R,2R)-2-fluorocyclopropyl]sulfonyl-4-methyl-1,3-thiazole (CAS 2375924-09-5) is a chemical compound with the molecular formula C7H8FNO2S2 and a molecular weight of 221.3 g/mol. IUPAC name: 2-[(1R,2R)-2-fluorocyclopropyl]sulfonyl-4-methyl-1,3-thiazole. InChIKey: IUATWWFJAFQCIU-PHDIDXHHSA-N.
| Molecular formula | C7H8FNO2S2 |
|---|---|
| Molecular weight | 221.3 g/mol |
| IUPAC name | 2-[(1R,2R)-2-fluorocyclopropyl]sulfonyl-4-methyl-1,3-thiazole |
| InChIKey | IUATWWFJAFQCIU-PHDIDXHHSA-N |
| SMILES | CC1=CSC(=N1)S(=O)(=O)[C@@H]2C[C@H]2F |
Computed by PubChem (NCBI)