CAS 2193067-89-7 is the registry number for 2-chloropyridine-4-sulfinate lithium (I). Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium 2-chloropyridine-4-sulfinate (CAS 2193067-89-7) is a chemical compound with the molecular formula C5H3ClLiNO2S and a molecular weight of 183.6 g/mol. IUPAC name: lithium 2-chloropyridine-4-sulfinate. InChIKey: VPKVASDNWAGFCU-UHFFFAOYSA-M.
| Molecular formula | C5H3ClLiNO2S |
|---|---|
| Molecular weight | 183.6 g/mol |
| IUPAC name | lithium 2-chloropyridine-4-sulfinate |
| InChIKey | VPKVASDNWAGFCU-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CN=C(C=C1S(=O)[O-])Cl |
Computed by PubChem (NCBI)