CAS 2225142-15-2 is the registry number for 6-chloropyridine-2-sulfinate lithium (I). Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Lithium 6-chloropyridine-2-sulfinate (CAS 2225142-15-2) is a chemical compound with the molecular formula C5H3ClLiNO2S and a molecular weight of 183.6 g/mol. IUPAC name: lithium 6-chloropyridine-2-sulfinate. InChIKey: UOQONBAQQXIQKT-UHFFFAOYSA-M.
| Molecular formula | C5H3ClLiNO2S |
|---|---|
| Molecular weight | 183.6 g/mol |
| IUPAC name | lithium 6-chloropyridine-2-sulfinate |
| InChIKey | UOQONBAQQXIQKT-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC(=NC(=C1)Cl)S(=O)[O-] |
Computed by PubChem (NCBI)