CAS 219310-11-9 appears in our catalog under these names: (3R)–3–Amino–3–cyclohexylpropanoic acid hydrochloride, (3R)-3-Amino-3-cyclohexylpropanoic acid hydrochloride, (3R)-3-Amino-3-cyclohexylpropanoic acid hydrochloride, 95%, 95%, (3R)-3-Amino-3-cyclohexylpropanoic acid hydrochloride, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 0,5g, 5g, 250mg, 1g.
(3R)-3-amino-3-cyclohexylpropanoic acid;hydrochloride (CAS 219310-11-9) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: (3R)-3-amino-3-cyclohexylpropanoic acid;hydrochloride. InChIKey: KGHIZRPOMNZQAX-DDWIOCJRSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | (3R)-3-amino-3-cyclohexylpropanoic acid;hydrochloride |
| InChIKey | KGHIZRPOMNZQAX-DDWIOCJRSA-N |
| SMILES | C1CCC(CC1)[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)