Products 219310-11-9

CAS 219310-11-9 appears in our catalog under these names: (3R)–3–Amino–3–cyclohexylpropanoic acid hydrochloride, (3R)-3-Amino-3-cyclohexylpropanoic acid hydrochloride, (3R)-3-Amino-3-cyclohexylpropanoic acid hydrochloride, 95%, 95%, (3R)-3-Amino-3-cyclohexylpropanoic acid hydrochloride, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 0,5g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(3R)-3-amino-3-cyclohexylpropanoic acid;hydrochloride (CAS 219310-11-9) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: (3R)-3-amino-3-cyclohexylpropanoic acid;hydrochloride. InChIKey: KGHIZRPOMNZQAX-DDWIOCJRSA-N.

Identity
Molecular formulaC9H18ClNO2
Molecular weight207.70 g/mol
IUPAC name(3R)-3-amino-3-cyclohexylpropanoic acid;hydrochloride
InChIKeyKGHIZRPOMNZQAX-DDWIOCJRSA-N
SMILESC1CCC(CC1)[C@@H](CC(=O)O)N.Cl

Computed by PubChem (NCBI)