CAS 219312-97-7 is the registry number for 2-(2,4,6-Trichloropyrimidin-5-yl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4,6-trichloropyrimidin-5-yl)ethanol (CAS 219312-97-7) is a chemical compound with the molecular formula C6H5Cl3N2O and a molecular weight of 227.5 g/mol. IUPAC name: 2-(2,4,6-trichloropyrimidin-5-yl)ethanol. InChIKey: GSHMPGHQXQWRHC-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl3N2O |
|---|---|
| Molecular weight | 227.5 g/mol |
| IUPAC name | 2-(2,4,6-trichloropyrimidin-5-yl)ethanol |
| InChIKey | GSHMPGHQXQWRHC-UHFFFAOYSA-N |
| SMILES | C(CO)C1=C(N=C(N=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)