CAS 2489629-97-0 is the registry number for 1-(2,4,6-Trichloropyrimidin-5-yl)ethan-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(2,4,6-trichloropyrimidin-5-yl)ethanol (CAS 2489629-97-0) is a chemical compound with the molecular formula C6H5Cl3N2O and a molecular weight of 227.5 g/mol. IUPAC name: 1-(2,4,6-trichloropyrimidin-5-yl)ethanol. InChIKey: ZQKWEPARCXKTLA-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl3N2O |
|---|---|
| Molecular weight | 227.5 g/mol |
| IUPAC name | 1-(2,4,6-trichloropyrimidin-5-yl)ethanol |
| InChIKey | ZQKWEPARCXKTLA-UHFFFAOYSA-N |
| SMILES | CC(C1=C(N=C(N=C1Cl)Cl)Cl)O |
Computed by PubChem (NCBI)