CAS 21945-69-7 is the registry number for (2,3-dimethylphenyl)(phenyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,3-dimethylphenyl)-phenylmethanol (CAS 21945-69-7) is a chemical compound with the molecular formula C15H16O and a molecular weight of 212.29 g/mol. IUPAC name: (2,3-dimethylphenyl)-phenylmethanol. InChIKey: CBYKCEBNXVEAFY-UHFFFAOYSA-N.
| Molecular formula | C15H16O |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | (2,3-dimethylphenyl)-phenylmethanol |
| InChIKey | CBYKCEBNXVEAFY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(C2=CC=CC=C2)O)C |
Computed by PubChem (NCBI)