CAS 219528-73-1 appears in our catalog under these names: N-(4-Fluorophenyl)-2-(N'-hydroxycarbamimidoyl)acetamide, 95%, N-(4-Fluorophenyl)-2-(N'-hydroxycarbamimidoyl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
(3Z)-3-amino-N-(4-fluorophenyl)-3-hydroxyiminopropanamide (CAS 219528-73-1) is a chemical compound with the molecular formula C9H10FN3O2 and a molecular weight of 211.19 g/mol. IUPAC name: (3Z)-3-amino-N-(4-fluorophenyl)-3-hydroxyiminopropanamide. InChIKey: VLVIIBOTKFMAIF-UHFFFAOYSA-N.
| Molecular formula | C9H10FN3O2 |
|---|---|
| Molecular weight | 211.19 g/mol |
| IUPAC name | (3Z)-3-amino-N-(4-fluorophenyl)-3-hydroxyiminopropanamide |
| InChIKey | VLVIIBOTKFMAIF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C/C(=N/O)/N)F |
Computed by PubChem (NCBI)