CAS 330470-64-9 is the registry number for Glycine, N-(3-fluorobenzoyl)-, hydrazide, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
3-fluoro-N-(2-hydrazinyl-2-oxoethyl)benzamide (CAS 330470-64-9) is a chemical compound with the molecular formula C9H10FN3O2 and a molecular weight of 211.19 g/mol. IUPAC name: 3-fluoro-N-(2-hydrazinyl-2-oxoethyl)benzamide. InChIKey: IJNQVWYRRDRZJB-UHFFFAOYSA-N.
| Molecular formula | C9H10FN3O2 |
|---|---|
| Molecular weight | 211.19 g/mol |
| IUPAC name | 3-fluoro-N-(2-hydrazinyl-2-oxoethyl)benzamide |
| InChIKey | IJNQVWYRRDRZJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)NCC(=O)NN |
Computed by PubChem (NCBI)