Products 2195411-63-1
CAS 2195411-63-1 is the registry number for DSO-5a. Offered by: MedChemExpress. Available pack sizes: Get quote.
[1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]-2,2-dimethylbut-3-enyl] furan-2-carboxylate (CAS 2195411-63-1) is a chemical compound with the molecular formula C23H24N2O7 and a molecular weight of 440.4 g/mol. IUPAC name: [1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]-2,2-dimethylbut-3-enyl] furan-2-carboxylate. InChIKey: WUXGQZUWKGBOKK-UHFFFAOYSA-N.
| Molecular formula | C23H24N2O7 |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | [1-[5-(hydroxyamino)-1,4-dimethoxy-8-nitrosonaphthalen-2-yl]-2,2-dimethylbut-3-enyl] furan-2-carboxylate |
| InChIKey | WUXGQZUWKGBOKK-UHFFFAOYSA-N |
| SMILES | CC(C)(C=C)C(C1=C(C2=C(C=CC(=C2C(=C1)OC)NO)N=O)OC)OC(=O)C3=CC=CO3 |
Computed by PubChem (NCBI)
Synonyms:
Dimethyl Shikonin Oxime 5a, orb1944300