Products 2242792-25-0
CAS 2242792-25-0 is the registry number for AChE-IN-15. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-[7-[ethyl(methyl)carbamoyl]oxy-5-hydroxy-4-oxochromen-2-yl]phenyl] N-ethyl-N-methylcarbamate (CAS 2242792-25-0) is a chemical compound with the molecular formula C23H24N2O7 and a molecular weight of 440.4 g/mol. IUPAC name: [4-[7-[ethyl(methyl)carbamoyl]oxy-5-hydroxy-4-oxochromen-2-yl]phenyl] N-ethyl-N-methylcarbamate. InChIKey: HVXLNJOMSHCFDF-UHFFFAOYSA-N.
| Molecular formula | C23H24N2O7 |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | [4-[7-[ethyl(methyl)carbamoyl]oxy-5-hydroxy-4-oxochromen-2-yl]phenyl] N-ethyl-N-methylcarbamate |
| InChIKey | HVXLNJOMSHCFDF-UHFFFAOYSA-N |
| SMILES | CCN(C)C(=O)OC1=CC=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)OC(=O)N(C)CC)O |
Computed by PubChem (NCBI)
Synonyms:
AChE-IN-15, orb1687506