CAS 219580-24-2 is the registry number for Tert-butyl 3,5-dimethyl-1H-pyrazole-1-carboxylate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl 3,5-dimethylpyrazole-1-carboxylate (CAS 219580-24-2) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: tert-butyl 3,5-dimethylpyrazole-1-carboxylate. InChIKey: XTBISQIOEDXGGJ-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | tert-butyl 3,5-dimethylpyrazole-1-carboxylate |
| InChIKey | XTBISQIOEDXGGJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)