Products 2196245-98-2
CAS 2196245-98-2 is the registry number for DNS-pE. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-ethenylsulfonyl-N,N-dimethylnaphthalen-2-amine (CAS 2196245-98-2) is a chemical compound with the molecular formula C14H15NO2S and a molecular weight of 261.34 g/mol. IUPAC name: 6-ethenylsulfonyl-N,N-dimethylnaphthalen-2-amine. InChIKey: LFACUIVWKWTUSE-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2S |
|---|---|
| Molecular weight | 261.34 g/mol |
| IUPAC name | 6-ethenylsulfonyl-N,N-dimethylnaphthalen-2-amine |
| InChIKey | LFACUIVWKWTUSE-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C=C(C=C2)S(=O)(=O)C=C |
Computed by PubChem (NCBI)
Synonyms:
DNS-pE, orb1697370