CAS 2197-57-1 appears in our catalog under these names: 2,3-Dimethylnaphthalene-1,4-dione, 95%, 2,3-Dimethyl-1,4-dihydronaphthalene-1,4-dione. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 250mg, 25mg, 50mg, 100mg, 500mg.
2,3-dimethylnaphthalene-1,4-dione (CAS 2197-57-1) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. IUPAC name: 2,3-dimethylnaphthalene-1,4-dione. InChIKey: LGFDNUSAWCHVJN-UHFFFAOYSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 2,3-dimethylnaphthalene-1,4-dione |
| InChIKey | LGFDNUSAWCHVJN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)C |
Computed by PubChem (NCBI)