CAS 2197044-57-6 is the registry number for 3'-Amino-2',3'-dideoxyinosine. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg.
9-[(2R,4R,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 2197044-57-6) is a chemical compound with the molecular formula C10H13N5O3 and a molecular weight of 251.24 g/mol. IUPAC name: 9-[(2R,4R,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: CHWLAIBBKPETPZ-FSDSQADBSA-N.
| Molecular formula | C10H13N5O3 |
|---|---|
| Molecular weight | 251.24 g/mol |
| IUPAC name | 9-[(2R,4R,5S)-4-amino-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | CHWLAIBBKPETPZ-FSDSQADBSA-N |
| SMILES | C1[C@H]([C@H](O[C@H]1N2C=NC3=C2N=CNC3=O)CO)N |
Computed by PubChem (NCBI)