CAS 2197983-31-4 is the registry number for 16(R),17(S)-diHDHA. Offered by: TRC. Available pack sizes: 100mg.
(4Z,7Z,10Z,12E,14E,16R,17S,19Z)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid (CAS 2197983-31-4) is a chemical compound with the molecular formula C22H32O4 and a molecular weight of 360.5 g/mol. IUPAC name: (4Z,7Z,10Z,12E,14E,16R,17S,19Z)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid. InChIKey: RHERWTKCXOXCNX-DWQDBCEISA-N.
| Molecular formula | C22H32O4 |
|---|---|
| Molecular weight | 360.5 g/mol |
| IUPAC name | (4Z,7Z,10Z,12E,14E,16R,17S,19Z)-16,17-dihydroxydocosa-4,7,10,12,14,19-hexaenoic acid |
| InChIKey | RHERWTKCXOXCNX-DWQDBCEISA-N |
| SMILES | CC/C=C\C[C@@H]([C@@H](/C=C/C=C/C=C\C/C=C\C/C=C\CCC(=O)O)O)O |
Computed by PubChem (NCBI)