CAS 2198585-38-3 appears in our catalog under these names: 3-(Difluoro(phenyl)methyl)bicyclo(1.1.1)pentane-1-carboxylic acid, 97%, 3-[difluoro(phenyl)methyl]bicyclo[1.1.1]pentane-1-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
3-[difluoro(phenyl)methyl]bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2198585-38-3) is a chemical compound with the molecular formula C13H12F2O2 and a molecular weight of 238.23 g/mol. IUPAC name: 3-[difluoro(phenyl)methyl]bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: CKYWPTQZPPFIDB-UHFFFAOYSA-N.
| Molecular formula | C13H12F2O2 |
|---|---|
| Molecular weight | 238.23 g/mol |
| IUPAC name | 3-[difluoro(phenyl)methyl]bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | CKYWPTQZPPFIDB-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)C(C3=CC=CC=C3)(F)F)C(=O)O |
Computed by PubChem (NCBI)