CAS 2374237-88-2 is the registry number for Methyl 2,2-difluoro-3-phenylbicyclo[1.1.1]pentane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,2-difluoro-3-phenylbicyclo[1.1.1]pentane-1-carboxylate (CAS 2374237-88-2) is a chemical compound with the molecular formula C13H12F2O2 and a molecular weight of 238.23 g/mol. IUPAC name: methyl 2,2-difluoro-3-phenylbicyclo[1.1.1]pentane-1-carboxylate. InChIKey: VPAGTDIUHSKDIP-UHFFFAOYSA-N.
| Molecular formula | C13H12F2O2 |
|---|---|
| Molecular weight | 238.23 g/mol |
| IUPAC name | methyl 2,2-difluoro-3-phenylbicyclo[1.1.1]pentane-1-carboxylate |
| InChIKey | VPAGTDIUHSKDIP-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC(C1)(C2(F)F)C3=CC=CC=C3 |
Computed by PubChem (NCBI)