CAS 219865-85-7 is the registry number for 6-((2,5-Dichlorophenyl)thio)pyridin-3-amine, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g.
6-(2,5-dichlorophenyl)sulfanylpyridin-3-amine (CAS 219865-85-7) is a chemical compound with the molecular formula C11H8Cl2N2S and a molecular weight of 271.2 g/mol. IUPAC name: 6-(2,5-dichlorophenyl)sulfanylpyridin-3-amine. InChIKey: SNXRLTPQEPXSJN-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2S |
|---|---|
| Molecular weight | 271.2 g/mol |
| IUPAC name | 6-(2,5-dichlorophenyl)sulfanylpyridin-3-amine |
| InChIKey | SNXRLTPQEPXSJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)SC2=NC=C(C=C2)N)Cl |
Computed by PubChem (NCBI)