CAS 64415-11-8 is the registry number for 4,6-Dichloro-2-methylthio-5-phenylpyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g.
4,6-dichloro-2-methylsulfanyl-5-phenylpyrimidine (CAS 64415-11-8) is a chemical compound with the molecular formula C11H8Cl2N2S and a molecular weight of 271.2 g/mol. IUPAC name: 4,6-dichloro-2-methylsulfanyl-5-phenylpyrimidine. InChIKey: LMTMZMBTPXASSW-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2S |
|---|---|
| Molecular weight | 271.2 g/mol |
| IUPAC name | 4,6-dichloro-2-methylsulfanyl-5-phenylpyrimidine |
| InChIKey | LMTMZMBTPXASSW-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=C(C(=N1)Cl)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)