CAS 219904-95-7 is the registry number for (1,2-Dichlorotrifluoroethyl)cyclohexane, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(E)-1,2-dichloro-1,1,2-trifluorooct-3-ene (CAS 219904-95-7) is a chemical compound with the molecular formula C8H11Cl2F3 and a molecular weight of 235.07 g/mol. IUPAC name: (E)-1,2-dichloro-1,1,2-trifluorooct-3-ene. InChIKey: NEFLHKGXWFDDQU-AATRIKPKSA-N.
| Molecular formula | C8H11Cl2F3 |
|---|---|
| Molecular weight | 235.07 g/mol |
| IUPAC name | (E)-1,2-dichloro-1,1,2-trifluorooct-3-ene |
| InChIKey | NEFLHKGXWFDDQU-AATRIKPKSA-N |
| SMILES | CCCC/C=C/C(C(F)(F)Cl)(F)Cl |
Computed by PubChem (NCBI)