CAS 219904-98-0 is the registry number for (1,2-Dichlorotrifluoroethyl)cyclohexane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(1,2-dichloro-1,2,2-trifluoroethyl)cyclohexane (CAS 219904-98-0) is a chemical compound with the molecular formula C8H11Cl2F3 and a molecular weight of 235.07 g/mol. IUPAC name: (1,2-dichloro-1,2,2-trifluoroethyl)cyclohexane. InChIKey: NTMQOCVGFBDYTB-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2F3 |
|---|---|
| Molecular weight | 235.07 g/mol |
| IUPAC name | (1,2-dichloro-1,2,2-trifluoroethyl)cyclohexane |
| InChIKey | NTMQOCVGFBDYTB-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C(F)(F)Cl)(F)Cl |
Computed by PubChem (NCBI)