Products 2199213-79-9
CAS 2199213-79-9 appears in our catalog under these names: (S)-5-(tert-Butoxycarbonyl)-5-azaspiro[2.4]heptane-7-carboxylic acid, 98%, (S)-5-Boc-5-azaspiro[2.4]heptane-7-carboxylic Acid, >95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
(7S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[2.4]heptane-7-carboxylic acid (CAS 2199213-79-9) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: (7S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[2.4]heptane-7-carboxylic acid. InChIKey: XDFSKDGVRVJWGF-QMMMGPOBSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | (7S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[2.4]heptane-7-carboxylic acid |
| InChIKey | XDFSKDGVRVJWGF-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C2(C1)CC2)C(=O)O |
Computed by PubChem (NCBI)