CAS 2199500-16-6 is the registry number for rel-(1S,5R)-3,3-Difluoro-5-methylcyclohexane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1S,5R)-3,3-difluoro-5-methylcyclohexane-1-carboxylic acid (CAS 2199500-16-6) is a chemical compound with the molecular formula C8H12F2O2 and a molecular weight of 178.18 g/mol. IUPAC name: cis-(1S,5R)-3,3-difluoro-5-methylcyclohexane-1-carboxylic acid. InChIKey: FGDOYBLONFFUMM-RITPCOANSA-N.
| Molecular formula | C8H12F2O2 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | cis-(1S,5R)-3,3-difluoro-5-methylcyclohexane-1-carboxylic acid |
| InChIKey | FGDOYBLONFFUMM-RITPCOANSA-N |
| SMILES | C[C@@H]1C[C@@H](CC(C1)(F)F)C(=O)O |
Computed by PubChem (NCBI)