CAS 2199500-23-5 is the registry number for rel-(1R,5S)-3,3-Difluoro-5-(trifluoromethyl)cyclohexane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,5S)-3,3-difluoro-5-(trifluoromethyl)cyclohexane-1-carboxylic acid (CAS 2199500-23-5) is a chemical compound with the molecular formula C8H9F5O2 and a molecular weight of 232.15 g/mol. IUPAC name: cis-(1R,5S)-3,3-difluoro-5-(trifluoromethyl)cyclohexane-1-carboxylic acid. InChIKey: OXTZDLZIACPXTJ-UHNVWZDZSA-N.
| Molecular formula | C8H9F5O2 |
|---|---|
| Molecular weight | 232.15 g/mol |
| IUPAC name | cis-(1R,5S)-3,3-difluoro-5-(trifluoromethyl)cyclohexane-1-carboxylic acid |
| InChIKey | OXTZDLZIACPXTJ-UHNVWZDZSA-N |
| SMILES | C1[C@H](CC(C[C@H]1C(F)(F)F)(F)F)C(=O)O |
Computed by PubChem (NCBI)