CAS 885275-40-1 is the registry number for 2-(Pentafluoropropenyl)pivalate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
1,1,3,3,3-pentafluoroprop-1-en-2-yl 2,2-dimethylpropanoate (CAS 885275-40-1) is a chemical compound with the molecular formula C8H9F5O2 and a molecular weight of 232.15 g/mol. IUPAC name: 1,1,3,3,3-pentafluoroprop-1-en-2-yl 2,2-dimethylpropanoate. InChIKey: KHVGJDBCCPHABS-UHFFFAOYSA-N.
| Molecular formula | C8H9F5O2 |
|---|---|
| Molecular weight | 232.15 g/mol |
| IUPAC name | 1,1,3,3,3-pentafluoroprop-1-en-2-yl 2,2-dimethylpropanoate |
| InChIKey | KHVGJDBCCPHABS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC(=C(F)F)C(F)(F)F |
Computed by PubChem (NCBI)