CAS 219959-86-1 is the registry number for 9-(4’-Aminophenyl)-9H-pyrido(3,4-b)indole, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 5mg.
4-pyrido[3,4-b]indol-9-ylaniline (CAS 219959-86-1) is a chemical compound with the molecular formula C17H13N3 and a molecular weight of 259.30 g/mol. IUPAC name: 4-pyrido[3,4-b]indol-9-ylaniline. InChIKey: CKJBUSARXRFUDR-UHFFFAOYSA-N.
| Molecular formula | C17H13N3 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 4-pyrido[3,4-b]indol-9-ylaniline |
| InChIKey | CKJBUSARXRFUDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2C4=CC=C(C=C4)N)C=NC=C3 |
Computed by PubChem (NCBI)