Products 956728-61-3
CAS 956728-61-3 appears in our catalog under these names: 4'-(1H-Pyrazol-1-ylmethyl)-1,1'-biphenyl-2-carbonitrile, 95%, 2-(4-(1H-Pyrazol-1-ylmethyl)phenyl)benzonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[4-(pyrazol-1-ylmethyl)phenyl]benzonitrile (CAS 956728-61-3) is a chemical compound with the molecular formula C17H13N3 and a molecular weight of 259.30 g/mol. IUPAC name: 2-[4-(pyrazol-1-ylmethyl)phenyl]benzonitrile. InChIKey: ZCIMWPAAEBSURX-UHFFFAOYSA-N.
| Molecular formula | C17H13N3 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 2-[4-(pyrazol-1-ylmethyl)phenyl]benzonitrile |
| InChIKey | ZCIMWPAAEBSURX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C2=CC=C(C=C2)CN3C=CC=N3 |
Computed by PubChem (NCBI)