Products 917562-05-1

CAS 917562-05-1 is the registry number for 3-(9-H-Fluoren-9-ylmethoxycarbonylamino)-5-phenyl-pentanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid (CAS 917562-05-1) is a chemical compound with the molecular formula C26H25NO4 and a molecular weight of 415.5 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid. InChIKey: FYJRCXFXXJMPFO-UHFFFAOYSA-N.

Identity
Molecular formulaC26H25NO4
Molecular weight415.5 g/mol
IUPAC name3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-phenylpentanoic acid
InChIKeyFYJRCXFXXJMPFO-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCC(CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)