CAS 2200705-53-7 is the registry number for H-L-Phe(4-NMe2)-OH*HCl. Offered by: Iris Biotech. Available pack sizes: 50mg, 25mg.
(2S)-2-amino-3-[4-(dimethylamino)phenyl]propanoic acid;hydrochloride (CAS 2200705-53-7) is a chemical compound with the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. IUPAC name: (2S)-2-amino-3-[4-(dimethylamino)phenyl]propanoic acid;hydrochloride. InChIKey: VSSUJFJDJMEZOP-PPHPATTJSA-N.
| Molecular formula | C11H17ClN2O2 |
|---|---|
| Molecular weight | 244.72 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-(dimethylamino)phenyl]propanoic acid;hydrochloride |
| InChIKey | VSSUJFJDJMEZOP-PPHPATTJSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)