Products 22008-60-2
CAS 22008-60-2 is the registry number for For-Met-Phe-OH. Offered by: Creative Peptides, Biosynth. Available pack sizes: on request, 1000mg, 500mg, 2000mg.
(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-3-phenylpropanoic acid (CAS 22008-60-2) is a chemical compound with the molecular formula C15H20N2O4S and a molecular weight of 324.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-3-phenylpropanoic acid. InChIKey: VZQJQFGSAAGNSI-STQMWFEESA-N.
| Molecular formula | C15H20N2O4S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | VZQJQFGSAAGNSI-STQMWFEESA-N |
| SMILES | CSCC[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)NC=O |
Computed by PubChem (NCBI)