Products 2468796-77-0
CAS 2468796-77-0 appears in our catalog under these names: Acetohexamide-d11, >95% (HPLC), Acetohexamide-d11. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
1-(4-acetylphenyl)sulfonyl-3-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)urea (CAS 2468796-77-0) is a chemical compound with the molecular formula C15H20N2O4S and a molecular weight of 335.5 g/mol. IUPAC name: 1-(4-acetylphenyl)sulfonyl-3-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)urea. InChIKey: VGZSUPCWNCWDAN-CQFOJTSKSA-N.
| Molecular formula | C15H20N2O4S |
|---|---|
| Molecular weight | 335.5 g/mol |
| IUPAC name | 1-(4-acetylphenyl)sulfonyl-3-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)urea |
| InChIKey | VGZSUPCWNCWDAN-CQFOJTSKSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])NC(=O)NS(=O)(=O)C2=CC=C(C=C2)C(=O)C)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)