CAS 2201583-03-9 is the registry number for 1,1-Dimethylethyl (5R)-6-oxo-2,7-diazaspiro[4.4]nonane-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carboxylate (CAS 2201583-03-9) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carboxylate. InChIKey: RJXAFHSMTSRJKE-GFCCVEGCSA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl (5R)-1-oxo-2,7-diazaspiro[4.4]nonane-7-carboxylate |
| InChIKey | RJXAFHSMTSRJKE-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@]2(C1)CCNC2=O |
Computed by PubChem (NCBI)