CAS 220226-10-8 is the registry number for (S)-tert-Butyl ((5-oxopyrrolidin-3-yl)methyl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl N-[[(3S)-5-oxopyrrolidin-3-yl]methyl]carbamate (CAS 220226-10-8) is a chemical compound with the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. IUPAC name: tert-butyl N-[[(3S)-5-oxopyrrolidin-3-yl]methyl]carbamate. InChIKey: IIYJKESUJITBBK-ZETCQYMHSA-N.
| Molecular formula | C10H18N2O3 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | tert-butyl N-[[(3S)-5-oxopyrrolidin-3-yl]methyl]carbamate |
| InChIKey | IIYJKESUJITBBK-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1CC(=O)NC1 |
Computed by PubChem (NCBI)