CAS 220351-01-9 is the registry number for 5-(1,1-Dimethylethyl)-2'-(trifluoromethoxy)[1,1'-biphenyl]-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-tert-butyl-2-[2-(trifluoromethoxy)phenyl]aniline (CAS 220351-01-9) is a chemical compound with the molecular formula C17H18F3NO and a molecular weight of 309.33 g/mol. IUPAC name: 4-tert-butyl-2-[2-(trifluoromethoxy)phenyl]aniline. InChIKey: UCCMIJUVCMGBCF-UHFFFAOYSA-N.
| Molecular formula | C17H18F3NO |
|---|---|
| Molecular weight | 309.33 g/mol |
| IUPAC name | 4-tert-butyl-2-[2-(trifluoromethoxy)phenyl]aniline |
| InChIKey | UCCMIJUVCMGBCF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)N)C2=CC=CC=C2OC(F)(F)F |
Computed by PubChem (NCBI)