CAS 946682-74-2 is the registry number for [2-(2-Isopropyl-5-methylphenoxy)-5-(trifluoromethyl)phenyl]amine sulfate (salt), 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(5-methyl-2-propan-2-ylphenoxy)-5-(trifluoromethyl)aniline (CAS 946682-74-2) is a chemical compound with the molecular formula C17H18F3NO and a molecular weight of 309.33 g/mol. IUPAC name: 2-(5-methyl-2-propan-2-ylphenoxy)-5-(trifluoromethyl)aniline. InChIKey: NIFQQEGHPVQDNQ-UHFFFAOYSA-N.
| Molecular formula | C17H18F3NO |
|---|---|
| Molecular weight | 309.33 g/mol |
| IUPAC name | 2-(5-methyl-2-propan-2-ylphenoxy)-5-(trifluoromethyl)aniline |
| InChIKey | NIFQQEGHPVQDNQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(C)C)OC2=C(C=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)