CAS 220353-13-9 is the registry number for rac-(1R,2R)-2-(3,4-Dimethylphenyl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 0,05g.
Trans-(1R,2R)-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid (CAS 220353-13-9) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: trans-(1R,2R)-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid. InChIKey: FJKGZKQEZYZESI-WDEREUQCSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | FJKGZKQEZYZESI-WDEREUQCSA-N |
| SMILES | CC1=C(C=C(C=C1)[C@@H]2C[C@H]2C(=O)O)C |
Computed by PubChem (NCBI)