CAS 220353-65-1 appears in our catalog under these names: trans–2–(3,5–dimethylphenyl)cyclopropane–1–carboxylic acid, rac-(1R,2R)-2-(3,5-dimethylphenyl)cyclopropane-1-carboxylic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 500mg.
Trans-(1R,2R)-2-(3,5-dimethylphenyl)cyclopropane-1-carboxylic acid (CAS 220353-65-1) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: trans-(1R,2R)-2-(3,5-dimethylphenyl)cyclopropane-1-carboxylic acid. InChIKey: OPSVNKCRAMVFEI-WDEREUQCSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3,5-dimethylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | OPSVNKCRAMVFEI-WDEREUQCSA-N |
| SMILES | CC1=CC(=CC(=C1)[C@@H]2C[C@H]2C(=O)O)C |
Computed by PubChem (NCBI)