CAS 2204249-15-8 is the registry number for (E)-4,4'-(1,2-Diphenylethene-1,2-diyl)dibenzoic acid, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-[(E)-2-(4-carboxyphenyl)-1,2-diphenylethenyl]benzoic acid (CAS 2204249-15-8) is a chemical compound with the molecular formula C28H20O4 and a molecular weight of 420.5 g/mol. IUPAC name: 4-[(E)-2-(4-carboxyphenyl)-1,2-diphenylethenyl]benzoic acid. InChIKey: MTTUYJXPONEHGK-OCEACIFDSA-N.
| Molecular formula | C28H20O4 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 4-[(E)-2-(4-carboxyphenyl)-1,2-diphenylethenyl]benzoic acid |
| InChIKey | MTTUYJXPONEHGK-OCEACIFDSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C(/C2=CC=CC=C2)\C3=CC=C(C=C3)C(=O)O)/C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)