CAS 467-32-3 appears in our catalog under these names: 3,3,6,6-Tetraphenyl-1,4-dioxane-2,5-dione, 95+%, Trospium Impurity D, Trospium Impurity 2 (Benzilide), Benzilide, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g.
3,3,6,6-tetraphenyl-1,4-dioxane-2,5-dione (CAS 467-32-3) is a chemical compound with the molecular formula C28H20O4 and a molecular weight of 420.5 g/mol. IUPAC name: 3,3,6,6-tetraphenyl-1,4-dioxane-2,5-dione. InChIKey: PNHGDMUCPUQOLI-UHFFFAOYSA-N.
| Molecular formula | C28H20O4 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 3,3,6,6-tetraphenyl-1,4-dioxane-2,5-dione |
| InChIKey | PNHGDMUCPUQOLI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C(=O)OC(C(=O)O2)(C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)