Products 2204286-74-6

CAS 2204286-74-6 is the registry number for 3-Chloro-4-ethoxy-5-isopropoxybenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-chloro-4-ethoxy-5-propan-2-yloxybenzoic acid (CAS 2204286-74-6) is a chemical compound with the molecular formula C12H15ClO4 and a molecular weight of 258.70 g/mol. IUPAC name: 3-chloro-4-ethoxy-5-propan-2-yloxybenzoic acid. InChIKey: SPIAMMWLCGWMSV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15ClO4
Molecular weight258.70 g/mol
IUPAC name3-chloro-4-ethoxy-5-propan-2-yloxybenzoic acid
InChIKeySPIAMMWLCGWMSV-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1Cl)C(=O)O)OC(C)C

Computed by PubChem (NCBI)