Products 877964-62-0
CAS 877964-62-0 appears in our catalog under these names: 3-(2-Chloropropyl)-4,5-dimethoxybenzoic acid, 95%, 3-(2-Chloropropyl)-4,5-dimethoxybenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-(2-chloropropyl)-4,5-dimethoxybenzoic acid (CAS 877964-62-0) is a chemical compound with the molecular formula C12H15ClO4 and a molecular weight of 258.70 g/mol. IUPAC name: 3-(2-chloropropyl)-4,5-dimethoxybenzoic acid. InChIKey: GWVLZGIQZSLWOM-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO4 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 3-(2-chloropropyl)-4,5-dimethoxybenzoic acid |
| InChIKey | GWVLZGIQZSLWOM-UHFFFAOYSA-N |
| SMILES | CC(CC1=C(C(=CC(=C1)C(=O)O)OC)OC)Cl |
Computed by PubChem (NCBI)