CAS 2204562-89-8 is the registry number for 1-(2-Bromo-4-trifluoromethyl-phenyl)-ethylamine, hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[2-bromo-4-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 2204562-89-8) is a chemical compound with the molecular formula C9H10BrClF3N and a molecular weight of 304.53 g/mol. IUPAC name: 1-[2-bromo-4-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: CQZGJICHCZPTNB-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClF3N |
|---|---|
| Molecular weight | 304.53 g/mol |
| IUPAC name | 1-[2-bromo-4-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | CQZGJICHCZPTNB-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)C(F)(F)F)Br)N.Cl |
Computed by PubChem (NCBI)